C11H16N2O3S — CID 115276564
3,3-dimethyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-4-one (PubChem CID 115276564) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-4-one.
| Compound Name | 3,3-dimethyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-4-one |
|---|---|
| PubChem CID | 115276564 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3,3-dimethyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-4-one |
| SMILES | CC1(C)CN(S(=O)(=O)c2cc[nH]c2)CCC1=O |
| InChI | InChI=1S/C11H16N2O3S/c1-11(2)8-13(6-4-10(11)14)17(15,16)9-3-5-12-7-9/h3,5,7,12H,4,6,8H2,1-2H3 |
| InChIKey | CGVWNLLLMODOJB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |