C10H17N3O2S — CID 79994455
5-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-amine (PubChem CID 79994455) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 5-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-amine.
| Compound Name | 5-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-amine |
|---|---|
| PubChem CID | 79994455 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-methyl-1-(1H-pyrrol-3-ylsulfonyl)piperidin-3-amine |
| SMILES | CC1CC(N)CN(S(=O)(=O)c2cc[nH]c2)C1 |
| InChI | InChI=1S/C10H17N3O2S/c1-8-4-9(11)7-13(6-8)16(14,15)10-2-3-12-5-10/h2-3,5,8-9,12H,4,6-7,11H2,1H3 |
| InChIKey | DSAONQAEVKNNGR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |