C9H11N5 — CID 13046508
(5-benzyl-1H-1,2,4-triazol-3-yl)hydrazine (PubChem CID 13046508) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is (5-benzyl-1H-1,2,4-triazol-3-yl)hydrazine.
| Compound Name | (5-benzyl-1H-1,2,4-triazol-3-yl)hydrazine |
|---|---|
| PubChem CID | 13046508 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (5-benzyl-1H-1,2,4-triazol-3-yl)hydrazine |
| SMILES | NNc1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C9H11N5/c10-12-9-11-8(13-14-9)6-7-4-2-1-3-5-7/h1-5H,6,10H2,(H2,11,12,13,14) |
| InChIKey | XRYVBTZTDDFFNF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|