C35H36F2N8O4 — CID 130466309
N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-ylpyrimidine-5-carboxamide (PubChem CID 130466309) has the molecular formula C35H36F2N8O4 and a molecular weight of 670.72 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-ylpyrimidine-5-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 130466309 |
| Molecular Formula | C35H36F2N8O4 |
| Molecular Weight | 670.72 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | N-[4-[4-amino-7-[1-(2-methylpropanoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(2,5-difluorophenyl)-2,4-dioxo-1-propan-2-ylpyrimidine-5-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(c2cc(-c3ccc(NC(=O)c4cn(C(C)C)c(=O)n(-c5cc(F)ccc5F)c4=O)cc3)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C35H36F2N8O4/c1-19(2)33(47)42-13-11-22(12-14-42)28-16-25(30-31(38)39-18-40-45(28)30)21-5-8-24(9-6-21)41-32(46)26-17-43(20(3)4)35(49)44(34(26)48)29-15-23(36)7-10-27(29)37/h5-10,15-20,22H,11-14H2,1-4H3,(H,41,46)(H2,38,39,40) |
| InChIKey | RBJIDRHHQSINLM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |