C37H37FN8O4 — CID 130447751
N-[4-[4-amino-7-[1-[ethyl(methyl)carbamoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 130447751) has the molecular formula C37H37FN8O4 and a molecular weight of 676.75 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-[ethyl(methyl)carbamoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-[ethyl(methyl)carbamoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 130447751 |
| Molecular Formula | C37H37FN8O4 |
| Molecular Weight | 676.75 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | N-[4-[4-amino-7-[1-[ethyl(methyl)carbamoyl]piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | CCN(C)C(=O)N1CCC(c2cc(-c3ccc(NC(=O)c4cc5c(n(-c6ccc(F)cc6)c4=O)CCCC5=O)cc3)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C37H37FN8O4/c1-3-43(2)37(50)44-17-15-23(16-18-44)31-20-27(33-34(39)40-21-41-46(31)33)22-7-11-25(12-8-22)42-35(48)29-19-28-30(5-4-6-32(28)47)45(36(29)49)26-13-9-24(38)10-14-26/h7-14,19-21,23H,3-6,15-18H2,1-2H3,(H,42,48)(H2,39,40,41) |
| InChIKey | HSXPKDPRRLEBQG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 147.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |