C35H34FN7O4 — CID 130447658
N-[4-[4-amino-7-[1-(2-hydroxyethyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide (PubChem CID 130447658) has the molecular formula C35H34FN7O4 and a molecular weight of 635.70 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-(2-hydroxyethyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-(2-hydroxyethyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 130447658 |
| Molecular Formula | C35H34FN7O4 |
| Molecular Weight | 635.70 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | N-[4-[4-amino-7-[1-(2-hydroxyethyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-(4-fluorophenyl)-2,5-dioxo-7,8-dihydro-6H-quinoline-3-carboxamide |
| SMILES | Nc1ncnn2c(C3CCN(CCO)CC3)cc(-c3ccc(NC(=O)c4cc5c(n(-c6ccc(F)cc6)c4=O)CCCC5=O)cc3)c12 |
| InChI | InChI=1S/C35H34FN7O4/c36-23-6-10-25(11-7-23)42-29-2-1-3-31(45)27(29)18-28(35(42)47)34(46)40-24-8-4-21(5-9-24)26-19-30(43-32(26)33(37)38-20-39-43)22-12-14-41(15-13-22)16-17-44/h4-11,18-20,22,44H,1-3,12-17H2,(H,40,46)(H2,37,38,39) |
| InChIKey | NNTAENHFVLQVTG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 147.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |