C34H35FN6O4S — CID 165092765
N-[4-[4-amino-7-(1-methylsulfonylpiperidin-4-yl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-5-[2-(4-fluorophenyl)ethyl]-7-oxocyclohepta-1,3-diene-1-carboxamide (PubChem CID 165092765) has the molecular formula C34H35FN6O4S and a molecular weight of 642.76 g/mol. Its IUPAC name is N-[4-[4-amino-7-(1-methylsulfonylpiperidin-4-yl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-5-[2-(4-fluorophenyl)ethyl]-7-oxocyclohepta-1,3-diene-1-carboxamide.
| Compound Name | N-[4-[4-amino-7-(1-methylsulfonylpiperidin-4-yl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-5-[2-(4-fluorophenyl)ethyl]-7-oxocyclohepta-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 165092765 |
| Molecular Formula | C34H35FN6O4S |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | N-[4-[4-amino-7-(1-methylsulfonylpiperidin-4-yl)pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-5-[2-(4-fluorophenyl)ethyl]-7-oxocyclohepta-1,3-diene-1-carboxamide |
| SMILES | CS(=O)(=O)N1CCC(c2cc(-c3ccc(NC(=O)C4=CC=CC(CCc5ccc(F)cc5)CC4=O)cc3)c3c(N)ncnn23)CC1 |
| InChI | InChI=1S/C34H35FN6O4S/c1-46(44,45)40-17-15-25(16-18-40)30-20-29(32-33(36)37-21-38-41(30)32)24-9-13-27(14-10-24)39-34(43)28-4-2-3-23(19-31(28)42)6-5-22-7-11-26(35)12-8-22/h2-4,7-14,20-21,23,25H,5-6,15-19H2,1H3,(H,39,43)(H2,36,37,38) |
| InChIKey | WZLISGMXXULXJW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 139.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|