C33H36FN9O4 — CID 146047857
N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 146047857) has the molecular formula C33H36FN9O4 and a molecular weight of 641.71 g/mol. Its IUPAC name is N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 146047857 |
| Molecular Formula | C33H36FN9O4 |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | N-[4-[4-amino-7-[1-(dimethylcarbamoyl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-1-ethyl-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | CCN1CC(C(=O)Nc2ccc(-c3cc(C4CCN(C(=O)N(C)C)CC4)n4ncnc(N)c34)cc2)C(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C33H36FN9O4/c1-4-40-18-26(31(45)42(33(40)47)24-11-7-22(34)8-12-24)30(44)38-23-9-5-20(6-10-23)25-17-27(43-28(25)29(35)36-19-37-43)21-13-15-41(16-14-21)32(46)39(2)3/h5-12,17,19,21,26H,4,13-16,18H2,1-3H3,(H,38,44)(H2,35,36,37) |
| InChIKey | GYXTVDMCDOJUHU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|