C10H10N2O2S — CID 130466753
4-(3-methylsulfonylphenyl)-1H-pyrazole (PubChem CID 130466753) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is 4-(3-methylsulfonylphenyl)-1H-pyrazole.
| Compound Name | 4-(3-methylsulfonylphenyl)-1H-pyrazole |
|---|---|
| PubChem CID | 130466753 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 4-(3-methylsulfonylphenyl)-1H-pyrazole |
| SMILES | CS(=O)(=O)c1cccc(-c2cn[nH]c2)c1 |
| InChI | InChI=1S/C10H10N2O2S/c1-15(13,14)10-4-2-3-8(5-10)9-6-11-12-7-9/h2-7H,1H3,(H,11,12) |
| InChIKey | DPJWEXOBULILON-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |