C10H12F2IN3S — CID 130467094
3-[(1S,3R)-2,2-difluoro-3-iodocyclopropyl]-5-piperidin-1-yl-1,2,4-thiadiazole (PubChem CID 130467094) has the molecular formula C10H12F2IN3S and a molecular weight of 371.19 g/mol. Its IUPAC name is 3-[(1S,3R)-2,2-difluoro-3-iodocyclopropyl]-5-piperidin-1-yl-1,2,4-thiadiazole.
| Compound Name | 3-[(1S,3R)-2,2-difluoro-3-iodocyclopropyl]-5-piperidin-1-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 130467094 |
| Molecular Formula | C10H12F2IN3S |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 3-[(1S,3R)-2,2-difluoro-3-iodocyclopropyl]-5-piperidin-1-yl-1,2,4-thiadiazole |
| SMILES | FC1(F)[C@H](I)[C@H]1c1nsc(N2CCCCC2)n1 |
| InChI | InChI=1S/C10H12F2IN3S/c11-10(12)6(7(10)13)8-14-9(17-15-8)16-4-2-1-3-5-16/h6-7H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | GCFMTBCGKYKQFY-NKWVEPMBSA-N |
| XLogP | 3.06 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|