C17H31N3O5S — CID 130469192
4-[[(2R)-1-[2-(3-methylbutanoylamino)ethylamino]-1-oxo-3-propylsulfanylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 130469192) has the molecular formula C17H31N3O5S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-[[(2R)-1-[2-(3-methylbutanoylamino)ethylamino]-1-oxo-3-propylsulfanylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2R)-1-[2-(3-methylbutanoylamino)ethylamino]-1-oxo-3-propylsulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 130469192 |
| Molecular Formula | C17H31N3O5S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-[[(2R)-1-[2-(3-methylbutanoylamino)ethylamino]-1-oxo-3-propylsulfanylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCCSC[C@H](NC(=O)CCC(=O)O)C(=O)NCCNC(=O)CC(C)C |
| InChI | InChI=1S/C17H31N3O5S/c1-4-9-26-11-13(20-14(21)5-6-16(23)24)17(25)19-8-7-18-15(22)10-12(2)3/h12-13H,4-11H2,1-3H3,(H,18,22)(H,19,25)(H,20,21)(H,23,24)/t13-/m0/s1 |
| InChIKey | KCYFDYVWYRFNHP-ZDUSSCGKSA-N |
| XLogP | 0.76 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|