C26H32N8O5 — CID 130469922
7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-N-(5-nitro-4-piperidin-1-yl-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 130469922) has the molecular formula C26H32N8O5 and a molecular weight of 536.59 g/mol. Its IUPAC name is 7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-N-(5-nitro-4-piperidin-1-yl-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | 7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-N-(5-nitro-4-piperidin-1-yl-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 130469922 |
| Molecular Formula | C26H32N8O5 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-N-(5-nitro-4-piperidin-1-yl-2-pyridinyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | CN1CCN(Cc2cc3c(nc2C=O)N(C(=O)Nc2cc(N4CCCCC4)c([N+](=O)[O-])cn2)CCC3)C(=O)C1 |
| InChI | InChI=1S/C26H32N8O5/c1-30-10-11-32(24(36)16-30)15-19-12-18-6-5-9-33(25(18)28-20(19)17-35)26(37)29-23-13-21(22(14-27-23)34(38)39)31-7-3-2-4-8-31/h12-14,17H,2-11,15-16H2,1H3,(H,27,29,37) |
| InChIKey | WRXMBOBAARMRIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 145.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|