C23H28N8O5 — CID 130469918
N-[4-(ethylamino)-5-nitro-2-pyridinyl]-7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide (PubChem CID 130469918) has the molecular formula C23H28N8O5 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-[4-(ethylamino)-5-nitro-2-pyridinyl]-7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide.
| Compound Name | N-[4-(ethylamino)-5-nitro-2-pyridinyl]-7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
|---|---|
| PubChem CID | 130469918 |
| Molecular Formula | C23H28N8O5 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[4-(ethylamino)-5-nitro-2-pyridinyl]-7-formyl-6-[(4-methyl-2-oxopiperazin-1-yl)methyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxamide |
| SMILES | CCNc1cc(NC(=O)N2CCCc3cc(CN4CCN(C)CC4=O)c(C=O)nc32)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N8O5/c1-3-24-17-10-20(25-11-19(17)31(35)36)27-23(34)30-6-4-5-15-9-16(18(14-32)26-22(15)30)12-29-8-7-28(2)13-21(29)33/h9-11,14H,3-8,12-13H2,1-2H3,(H2,24,25,27,34) |
| InChIKey | KJHHASSPYQFKLL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 153.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|