C26H25FIN5O3S — CID 130470121
2-sulfanylpropan-2-yl 2-[1-[(2-fluoro-4,6-dimethylphenyl)methyl]indazol-3-yl]-4-iodooxy-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (PubChem CID 130470121) has the molecular formula C26H25FIN5O3S and a molecular weight of 633.49 g/mol. Its IUPAC name is 2-sulfanylpropan-2-yl 2-[1-[(2-fluoro-4,6-dimethylphenyl)methyl]indazol-3-yl]-4-iodooxy-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate.
| Compound Name | 2-sulfanylpropan-2-yl 2-[1-[(2-fluoro-4,6-dimethylphenyl)methyl]indazol-3-yl]-4-iodooxy-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 130470121 |
| Molecular Formula | C26H25FIN5O3S |
| Molecular Weight | 633.49 g/mol |
| Exact Mass | 633.07 |
| IUPAC Name | 2-sulfanylpropan-2-yl 2-[1-[(2-fluoro-4,6-dimethylphenyl)methyl]indazol-3-yl]-4-iodooxy-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| SMILES | Cc1cc(C)c(Cn2nc(-c3nc4c(c(OI)n3)CN(C(=O)OC(C)(C)S)C4)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C26H25FIN5O3S/c1-14-9-15(2)17(19(27)10-14)12-33-21-8-6-5-7-16(21)22(31-33)23-29-20-13-32(25(34)35-26(3,4)37)11-18(20)24(30-23)36-28/h5-10,37H,11-13H2,1-4H3 |
| InChIKey | AGTNMCQZMFLVIS-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|