C11H17N — CID 130472025
N-[(Z)-5-methylhex-1-enyl]buta-1,3-dien-1-imine (PubChem CID 130472025) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N-[(Z)-5-methylhex-1-enyl]buta-1,3-dien-1-imine.
| Compound Name | N-[(Z)-5-methylhex-1-enyl]buta-1,3-dien-1-imine |
|---|---|
| PubChem CID | 130472025 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N-[(Z)-5-methylhex-1-enyl]buta-1,3-dien-1-imine |
| SMILES | C=CC=C=N/C=C\CCC(C)C |
| InChI | InChI=1S/C11H17N/c1-4-5-9-12-10-7-6-8-11(2)3/h4-5,7,10-11H,1,6,8H2,2-3H3/b10-7- |
| InChIKey | JPKLYVDGZYJTBL-YFHOEESVSA-N |
| XLogP | 3.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|