C18H23NO2S — CID 130473660
2-methyl-5-[[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylmethyl]-1,3-dihydroisoindole (PubChem CID 130473660) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 2-methyl-5-[[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylmethyl]-1,3-dihydroisoindole.
| Compound Name | 2-methyl-5-[[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylmethyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 130473660 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-methyl-5-[[(3E)-6-methylhepta-1,3,5-trien-3-yl]sulfonylmethyl]-1,3-dihydroisoindole |
| SMILES | C=C/C(=C\C=C(C)C)S(=O)(=O)Cc1ccc2c(c1)CN(C)C2 |
| InChI | InChI=1S/C18H23NO2S/c1-5-18(9-6-14(2)3)22(20,21)13-15-7-8-16-11-19(4)12-17(16)10-15/h5-10H,1,11-13H2,2-4H3/b18-9+ |
| InChIKey | TZRCYJYOJWSPQZ-GIJQJNRQSA-N |
| XLogP | 3.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|