C21H23N3O4S — CID 130473974
[2-[[(5,6-dimethyl-3-pyridinyl)-hydroxymethyl]amino]-4-(furan-2-yl)-1,3-thiazol-5-yl]-(oxan-4-yl)methanone (PubChem CID 130473974) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is [2-[[(5,6-dimethyl-3-pyridinyl)-hydroxymethyl]amino]-4-(furan-2-yl)-1,3-thiazol-5-yl]-(oxan-4-yl)methanone.
| Compound Name | [2-[[(5,6-dimethyl-3-pyridinyl)-hydroxymethyl]amino]-4-(furan-2-yl)-1,3-thiazol-5-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 130473974 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [2-[[(5,6-dimethyl-3-pyridinyl)-hydroxymethyl]amino]-4-(furan-2-yl)-1,3-thiazol-5-yl]-(oxan-4-yl)methanone |
| SMILES | Cc1cc(C(O)Nc2nc(-c3ccco3)c(C(=O)C3CCOCC3)s2)cnc1C |
| InChI | InChI=1S/C21H23N3O4S/c1-12-10-15(11-22-13(12)2)20(26)24-21-23-17(16-4-3-7-28-16)19(29-21)18(25)14-5-8-27-9-6-14/h3-4,7,10-11,14,20,26H,5-6,8-9H2,1-2H3,(H,23,24) |
| InChIKey | GCPTZOFAALECKJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|