C14H14F3IN4O2S — CID 130474363
2-iodo-5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethylsulfanyl)-3-pyridinyl]oxy]pyrimidin-4-amine (PubChem CID 130474363) has the molecular formula C14H14F3IN4O2S and a molecular weight of 486.26 g/mol. Its IUPAC name is 2-iodo-5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethylsulfanyl)-3-pyridinyl]oxy]pyrimidin-4-amine.
| Compound Name | 2-iodo-5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethylsulfanyl)-3-pyridinyl]oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130474363 |
| Molecular Formula | C14H14F3IN4O2S |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | 2-iodo-5-[[6-methoxy-2-propan-2-yl-5-(trifluoromethylsulfanyl)-3-pyridinyl]oxy]pyrimidin-4-amine |
| SMILES | COc1nc(C(C)C)c(Oc2cnc(I)nc2N)cc1SC(F)(F)F |
| InChI | InChI=1S/C14H14F3IN4O2S/c1-6(2)10-7(24-8-5-20-13(18)22-11(8)19)4-9(12(21-10)23-3)25-14(15,16)17/h4-6H,1-3H3,(H2,19,20,22) |
| InChIKey | REEHBLPHBHFSIN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|