C22H23FN6O5 — CID 130474546
N-[6-(2-cyanoethoxy)-9-[(2R,3S,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]purin-2-yl]-2-phenoxyacetamide (PubChem CID 130474546) has the molecular formula C22H23FN6O5 and a molecular weight of 470.46 g/mol. Its IUPAC name is N-[6-(2-cyanoethoxy)-9-[(2R,3S,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]purin-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[6-(2-cyanoethoxy)-9-[(2R,3S,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]purin-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 130474546 |
| Molecular Formula | C22H23FN6O5 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-[6-(2-cyanoethoxy)-9-[(2R,3S,5S)-3-fluoro-5-(hydroxymethyl)-4-methyloxolan-2-yl]purin-2-yl]-2-phenoxyacetamide |
| SMILES | CC1[C@@H](CO)O[C@@H](n2cnc3c(OCCC#N)nc(NC(=O)COc4ccccc4)nc32)[C@H]1F |
| InChI | InChI=1S/C22H23FN6O5/c1-13-15(10-30)34-21(17(13)23)29-12-25-18-19(29)27-22(28-20(18)32-9-5-8-24)26-16(31)11-33-14-6-3-2-4-7-14/h2-4,6-7,12-13,15,17,21,30H,5,9-11H2,1H3,(H,26,27,28,31)/t13?,15-,17+,21-/m1/s1 |
| InChIKey | XTUDIDKPEHRRMD-JVZHALBLSA-N |
| XLogP | 2.00 |
| TPSA | 144.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|