C24H31N6O9P — CID 58679049
prop-2-enyl N-[9-[(2R,3S,5R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphoryl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-prop-2-enoxypurin-2-yl]carbamate (PubChem CID 58679049) has the molecular formula C24H31N6O9P and a molecular weight of 578.52 g/mol. Its IUPAC name is prop-2-enyl N-[9-[(2R,3S,5R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphoryl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-prop-2-enoxypurin-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[9-[(2R,3S,5R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphoryl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-prop-2-enoxypurin-2-yl]carbamate |
|---|---|
| PubChem CID | 58679049 |
| Molecular Formula | C24H31N6O9P |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | prop-2-enyl N-[9-[(2R,3S,5R)-4-[2-cyanoethoxy(prop-2-enoxy)phosphoryl]oxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-prop-2-enoxypurin-2-yl]carbamate |
| SMILES | C=CCOC(=O)Nc1nc(OCC=C)c2ncn([C@@H]3O[C@H](CO)C(OP(=O)(OCC=C)OCCC#N)[C@@H]3C)c2n1 |
| InChI | InChI=1S/C24H31N6O9P/c1-5-10-34-21-18-20(27-23(28-21)29-24(32)35-11-6-2)30(15-26-18)22-16(4)19(17(14-31)38-22)39-40(33,36-12-7-3)37-13-8-9-25/h5-7,15-17,19,22,31H,1-3,8,10-14H2,4H3,(H,27,28,29,32)/t16-,17+,19?,22+,40?/m0/s1 |
| InChIKey | QQYPHCIARMJKGH-JMNYIOJSSA-N |
| XLogP | 3.28 |
| TPSA | 189.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|