C17H34NO9PS — CID 130474562
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(2-methylpropan-2-yl)oxy-propan-2-yloxyphosphoryl]sulfanylethoxy]oxan-3-yl]acetamide (PubChem CID 130474562) has the molecular formula C17H34NO9PS and a molecular weight of 459.50 g/mol. Its IUPAC name is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(2-methylpropan-2-yl)oxy-propan-2-yloxyphosphoryl]sulfanylethoxy]oxan-3-yl]acetamide.
| Compound Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(2-methylpropan-2-yl)oxy-propan-2-yloxyphosphoryl]sulfanylethoxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 130474562 |
| Molecular Formula | C17H34NO9PS |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(2-methylpropan-2-yl)oxy-propan-2-yloxyphosphoryl]sulfanylethoxy]oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(OCCSP(=O)(OC(C)C)OC(C)(C)C)OC(CO)C(O)C1O |
| InChI | InChI=1S/C17H34NO9PS/c1-10(2)26-28(23,27-17(4,5)6)29-8-7-24-16-13(18-11(3)20)15(22)14(21)12(9-19)25-16/h10,12-16,19,21-22H,7-9H2,1-6H3,(H,18,20) |
| InChIKey | RWYXDRBEBRADIP-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|