C22H44NO12P — CID 155479200
[(2R)-1-[2-[2-[(3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]-4,4-dimethylpentan-2-yl] propan-2-yl hydrogen phosphate (PubChem CID 155479200) has the molecular formula C22H44NO12P and a molecular weight of 545.56 g/mol. Its IUPAC name is [(2R)-1-[2-[2-[(3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]-4,4-dimethylpentan-2-yl] propan-2-yl hydrogen phosphate.
| Compound Name | [(2R)-1-[2-[2-[(3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]-4,4-dimethylpentan-2-yl] propan-2-yl hydrogen phosphate |
|---|---|
| PubChem CID | 155479200 |
| Molecular Formula | C22H44NO12P |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | [(2R)-1-[2-[2-[(3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]-4,4-dimethylpentan-2-yl] propan-2-yl hydrogen phosphate |
| SMILES | CC(=O)N[C@H]1C(OCCOCCOC[C@@H](CC(C)(C)C)OP(=O)(O)OC(C)C)O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H44NO12P/c1-14(2)34-36(28,29)35-16(11-22(4,5)6)13-31-8-7-30-9-10-32-21-18(23-15(3)25)20(27)19(26)17(12-24)33-21/h14,16-21,24,26-27H,7-13H2,1-6H3,(H,23,25)(H,28,29)/t16-,17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | UWLRRIXVLKARQC-RTBGRNOFSA-N |
| XLogP | 0.33 |
| TPSA | 182.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|