C27H22N6O3S — CID 130475085
N-(1-cyanopyrrolidin-3-yl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130475085) has the molecular formula C27H22N6O3S and a molecular weight of 510.58 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130475085 |
| Molecular Formula | C27H22N6O3S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)NC3CCN(C#N)C3)sc3nccc1c23 |
| InChI | InChI=1S/C27H22N6O3S/c1-16-13-19(36-18-5-3-2-4-6-18)7-8-20(16)33-21-9-11-29-26-22(21)23(31-27(33)35)24(37-26)25(34)30-17-10-12-32(14-17)15-28/h2-9,11,13,17H,10,12,14H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | XZSCGRLXALLFLR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|