C27H21N5O4S — CID 129222814
7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-5-(oxomethylidene)pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129222814) has the molecular formula C27H21N5O4S and a molecular weight of 511.56 g/mol. Its IUPAC name is 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-5-(oxomethylidene)pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-5-(oxomethylidene)pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129222814 |
| Molecular Formula | C27H21N5O4S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-5-(oxomethylidene)pyrrolidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)N[C@H]3CNC(=C=O)C3)sc3nccc1c23 |
| InChI | InChI=1S/C27H21N5O4S/c1-15-11-19(36-18-5-3-2-4-6-18)7-8-20(15)32-21-9-10-28-26-22(21)23(31-27(32)35)24(37-26)25(34)30-16-12-17(14-33)29-13-16/h2-11,16,29H,12-13H2,1H3,(H,30,34)(H,31,35)/t16-/m1/s1 |
| InChIKey | PXQVEEZBZSGMBG-MRXNPFEDSA-N |
| XLogP | 4.89 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|