C30H27N5O4S — CID 129234146
7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129234146) has the molecular formula C30H27N5O4S and a molecular weight of 553.64 g/mol. Its IUPAC name is 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129234146 |
| Molecular Formula | C30H27N5O4S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(3R)-3-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1CCC(NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C30H27N5O4S/c1-3-24(36)32-18-9-10-19(16-18)33-28(37)27-26-25-23(13-14-31-29(25)40-27)35(30(38)34-26)22-12-11-21(15-17(22)2)39-20-7-5-4-6-8-20/h3-8,11-15,18-19H,1,9-10,16H2,2H3,(H,32,36)(H,33,37)(H,34,38)/t18-,19?/m1/s1 |
| InChIKey | AYJXOAOLPKBJSB-MRTLOADZSA-N |
| XLogP | 6.03 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|