C29H25N5O4S2 — CID 142369163
7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(5S)-3-prop-2-enoyl-1,3-thiazinan-5-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 142369163) has the molecular formula C29H25N5O4S2 and a molecular weight of 571.68 g/mol. Its IUPAC name is 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(5S)-3-prop-2-enoyl-1,3-thiazinan-5-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(5S)-3-prop-2-enoyl-1,3-thiazinan-5-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 142369163 |
| Molecular Formula | C29H25N5O4S2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 7-(2-methyl-4-phenoxyphenyl)-6-oxo-N-[(5S)-3-prop-2-enoyl-1,3-thiazinan-5-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CSC[C@@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C29H25N5O4S2/c1-3-23(35)33-14-18(15-39-16-33)31-27(36)26-25-24-22(11-12-30-28(24)40-26)34(29(37)32-25)21-10-9-20(13-17(21)2)38-19-7-5-4-6-8-19/h3-13,18H,1,14-16H2,2H3,(H,31,36)(H,32,37)/t18-/m0/s1 |
| InChIKey | GDTIRTZKUPJGHO-SFHVURJKSA-N |
| XLogP | 5.90 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|