C32H30N6O6S — CID 130475286
[(E)-4-[3-[[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidin-1-yl]-4-oxobut-2-enyl]carbamic acid (PubChem CID 130475286) has the molecular formula C32H30N6O6S and a molecular weight of 626.70 g/mol. Its IUPAC name is [(E)-4-[3-[[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidin-1-yl]-4-oxobut-2-enyl]carbamic acid.
| Compound Name | [(E)-4-[3-[[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidin-1-yl]-4-oxobut-2-enyl]carbamic acid |
|---|---|
| PubChem CID | 130475286 |
| Molecular Formula | C32H30N6O6S |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | [(E)-4-[3-[[7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidin-1-yl]-4-oxobut-2-enyl]carbamic acid |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)Nc2c(C(=O)NC3CCCN(C(=O)/C=C/CNC(=O)O)C3)sc3nccc1c23 |
| InChI | InChI=1S/C32H30N6O6S/c1-19-17-22(44-21-8-3-2-4-9-21)11-12-23(19)38-24-13-15-33-30-26(24)27(36-31(38)41)28(45-30)29(40)35-20-7-6-16-37(18-20)25(39)10-5-14-34-32(42)43/h2-5,8-13,15,17,20,34H,6-7,14,16,18H2,1H3,(H,35,40)(H,36,41)(H,42,43)/b10-5+ |
| InChIKey | AZOYCYWVLBACBN-BJMVGYQFSA-N |
| XLogP | 5.63 |
| TPSA | 153.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|