C33H34N6O3S — CID 129223055
N-[(3R)-1-[(3E)-5-(methylamino)penta-1,3-dien-2-yl]piperidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129223055) has the molecular formula C33H34N6O3S and a molecular weight of 594.74 g/mol. Its IUPAC name is N-[(3R)-1-[(3E)-5-(methylamino)penta-1,3-dien-2-yl]piperidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(3R)-1-[(3E)-5-(methylamino)penta-1,3-dien-2-yl]piperidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129223055 |
| Molecular Formula | C33H34N6O3S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | N-[(3R)-1-[(3E)-5-(methylamino)penta-1,3-dien-2-yl]piperidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=C(/C=C/CNC)N1CCC[C@@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C33H34N6O3S/c1-21-19-25(42-24-11-5-4-6-12-24)13-14-26(21)39-27-15-17-35-32-28(27)29(37-33(39)41)30(43-32)31(40)36-23-10-8-18-38(20-23)22(2)9-7-16-34-3/h4-7,9,11-15,17,19,23,34H,2,8,10,16,18,20H2,1,3H3,(H,36,40)(H,37,41)/b9-7+/t23-/m1/s1 |
| InChIKey | YEHAVVGQRHMESG-ISGGHPHESA-N |
| XLogP | 6.56 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|