C33H33ClN6O3S — CID 129222975
3-[1-[[1-[(Z)-2-chloro-4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]ethenyl]-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 129222975) has the molecular formula C33H33ClN6O3S and a molecular weight of 629.19 g/mol. Its IUPAC name is 3-[1-[[1-[(Z)-2-chloro-4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]ethenyl]-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 3-[1-[[1-[(Z)-2-chloro-4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]ethenyl]-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 129222975 |
| Molecular Formula | C33H33ClN6O3S |
| Molecular Weight | 629.19 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | 3-[1-[[1-[(Z)-2-chloro-4-(methylamino)but-2-enoyl]piperidin-3-yl]amino]ethenyl]-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | C=C(NC1CCCN(C(=O)/C(Cl)=C/CNC)C1)c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2ccccc2)cc1C |
| InChI | InChI=1S/C33H33ClN6O3S/c1-20-18-24(43-23-9-5-4-6-10-23)11-12-26(20)40-27-14-16-36-31-28(27)29(38-33(40)42)30(44-31)21(2)37-22-8-7-17-39(19-22)32(41)25(34)13-15-35-3/h4-6,9-14,16,18,22,35,37H,2,7-8,15,17,19H2,1,3H3,(H,38,42)/b25-13- |
| InChIKey | KDDVEWQYTMIKPV-MXAYSNPKSA-N |
| XLogP | 6.97 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.19 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|