C29H28FN5O4S3 — CID 161367998
N-[(3S,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane (PubChem CID 161367998) has the molecular formula C29H28FN5O4S3 and a molecular weight of 625.77 g/mol. Its IUPAC name is N-[(3S,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane.
| Compound Name | N-[(3S,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane |
|---|---|
| PubChem CID | 161367998 |
| Molecular Formula | C29H28FN5O4S3 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.13 |
| IUPAC Name | N-[(3S,4S)-4-fluoro-1-prop-2-enoylpyrrolidin-3-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;sulfane |
| SMILES | C=CC(=O)N1C[C@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)cc2C)[C@@H](F)C1.S.S |
| InChI | InChI=1S/C29H24FN5O4S.2H2S/c1-3-23(36)34-14-19(30)20(15-34)32-27(37)26-25-24-22(11-12-31-28(24)40-26)35(29(38)33-25)21-10-9-18(13-16(21)2)39-17-7-5-4-6-8-17;;/h3-13,19-20H,1,14-15H2,2H3,(H,32,37)(H,33,38);2*1H2/t19-,20-;;/m0../s1 |
| InChIKey | VQBOEAPIRNBZDS-TULUPMBKSA-N |
| XLogP | 5.77 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|