C30H28N6O4S — CID 129234339
7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129234339) has the molecular formula C30H28N6O4S and a molecular weight of 568.66 g/mol. Its IUPAC name is 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129234339 |
| Molecular Formula | C30H28N6O4S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | 7-(4-methyl-6-phenoxy-3-pyridinyl)-6-oxo-N-[(3S)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCC(NC(=O)c2sc3nccc4c3c2NC(=O)N4c2cnc(Oc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C30H28N6O4S/c1-3-23(37)33-18-8-7-9-19(15-18)34-28(38)27-26-25-21(12-13-31-29(25)41-27)36(30(39)35-26)22-16-32-24(14-17(22)2)40-20-10-5-4-6-11-20/h3-6,10-14,16,18-19H,1,7-9,15H2,2H3,(H,33,37)(H,34,38)(H,35,39)/t18-,19?/m0/s1 |
| InChIKey | ICPCLNZRIQLKLT-OYKVQYDMSA-N |
| XLogP | 5.82 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|