C30H30N6O4S — CID 146639164
6-hydroxy-7-(4-methyl-6-phenoxy-3-pyridinyl)-N-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 146639164) has the molecular formula C30H30N6O4S and a molecular weight of 570.68 g/mol. Its IUPAC name is 6-hydroxy-7-(4-methyl-6-phenoxy-3-pyridinyl)-N-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-hydroxy-7-(4-methyl-6-phenoxy-3-pyridinyl)-N-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 146639164 |
| Molecular Formula | C30H30N6O4S |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 6-hydroxy-7-(4-methyl-6-phenoxy-3-pyridinyl)-N-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@@H]1CCC[C@@H](NC(=O)c2sc3nccc4c3c2NC(O)N4c2cnc(Oc3ccccc3)cc2C)C1 |
| InChI | InChI=1S/C30H30N6O4S/c1-3-23(37)33-18-8-7-9-19(15-18)34-28(38)27-26-25-21(12-13-31-29(25)41-27)36(30(39)35-26)22-16-32-24(14-17(22)2)40-20-10-5-4-6-11-20/h3-6,10-14,16,18-19,30,35,39H,1,7-9,15H2,2H3,(H,33,37)(H,34,38)/t18-,19-,30?/m1/s1 |
| InChIKey | RYCNHWDKAILLKZ-KRIWMHHLSA-N |
| XLogP | 4.97 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|