C29H26N6O3S — CID 134600337
N-[(3R)-3-[1-[6-oxo-7-(6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide (PubChem CID 134600337) has the molecular formula C29H26N6O3S and a molecular weight of 538.63 g/mol. Its IUPAC name is N-[(3R)-3-[1-[6-oxo-7-(6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide.
| Compound Name | N-[(3R)-3-[1-[6-oxo-7-(6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 134600337 |
| Molecular Formula | C29H26N6O3S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | N-[(3R)-3-[1-[6-oxo-7-(6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC[C@@H](NC(=C)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)nc2)C1 |
| InChI | InChI=1S/C29H26N6O3S/c1-3-23(36)33-19-10-9-18(15-19)32-17(2)27-26-25-22(13-14-30-28(25)39-27)35(29(37)34-26)20-11-12-24(31-16-20)38-21-7-5-4-6-8-21/h3-8,11-14,16,18-19,32H,1-2,9-10,15H2,(H,33,36)(H,34,37)/t18-,19?/m1/s1 |
| InChIKey | XCVATYJASHDJTC-MRTLOADZSA-N |
| XLogP | 5.95 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|