C29H26N6O2S — CID 134600331
N-[(1S,3R)-3-[1-[6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide (PubChem CID 134600331) has the molecular formula C29H26N6O2S and a molecular weight of 522.63 g/mol. Its IUPAC name is N-[(1S,3R)-3-[1-[6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide.
| Compound Name | N-[(1S,3R)-3-[1-[6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 134600331 |
| Molecular Formula | C29H26N6O2S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N-[(1S,3R)-3-[1-[6-oxo-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-3-yl]ethenylamino]cyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CC[C@@H](NC(=C)c2sc3nccc4c3c2NC(=O)N4c2ccnc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C29H26N6O2S/c1-3-24(36)33-20-10-9-19(15-20)32-17(2)27-26-25-23(12-14-31-28(25)38-27)35(29(37)34-26)21-11-13-30-22(16-21)18-7-5-4-6-8-18/h3-8,11-14,16,19-20,32H,1-2,9-10,15H2,(H,33,36)(H,34,37)/t19-,20+/m1/s1 |
| InChIKey | OBVGWFYRZNHRFJ-UXHICEINSA-N |
| XLogP | 5.83 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|