C29H25N5O3S — CID 160592682
6-oxo-N-[(1S,3S)-3-(2-oxobut-3-enyl)cyclopentyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 160592682) has the molecular formula C29H25N5O3S and a molecular weight of 523.62 g/mol. Its IUPAC name is 6-oxo-N-[(1S,3S)-3-(2-oxobut-3-enyl)cyclopentyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-N-[(1S,3S)-3-(2-oxobut-3-enyl)cyclopentyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 160592682 |
| Molecular Formula | C29H25N5O3S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 6-oxo-N-[(1S,3S)-3-(2-oxobut-3-enyl)cyclopentyl]-7-(2-phenyl-4-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)C[C@H]1CC[C@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccnc(-c3ccccc3)c2)C1 |
| InChI | InChI=1S/C29H25N5O3S/c1-2-21(35)15-17-8-9-19(14-17)32-27(36)26-25-24-23(11-13-31-28(24)38-26)34(29(37)33-25)20-10-12-30-22(16-20)18-6-4-3-5-7-18/h2-7,10-13,16-17,19H,1,8-9,14-15H2,(H,32,36)(H,33,37)/t17-,19-/m0/s1 |
| InChIKey | WYVJFUFQBCRJBB-HKUYNNGSSA-N |
| XLogP | 6.09 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|