C28H24N6O3S — CID 129222938
6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-7-(3-pyridin-4-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129222938) has the molecular formula C28H24N6O3S and a molecular weight of 524.61 g/mol. Its IUPAC name is 6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-7-(3-pyridin-4-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-7-(3-pyridin-4-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129222938 |
| Molecular Formula | C28H24N6O3S |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-7-(3-pyridin-4-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2cccc(-c3ccncc3)c2)C1 |
| InChI | InChI=1S/C28H24N6O3S/c1-2-22(35)33-14-4-6-19(16-33)31-26(36)25-24-23-21(10-13-30-27(23)38-25)34(28(37)32-24)20-7-3-5-18(15-20)17-8-11-29-12-9-17/h2-3,5,7-13,15,19H,1,4,6,14,16H2,(H,31,36)(H,32,37)/t19-/m1/s1 |
| InChIKey | YSNQCLVZKYAEJD-LJQANCHMSA-N |
| XLogP | 4.95 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|