C26H25N5O5S — CID 130475091
7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130475091) has the molecular formula C26H25N5O5S and a molecular weight of 519.58 g/mol. Its IUPAC name is 7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130475091 |
| Molecular Formula | C26H25N5O5S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCCC(NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(OC3COC3)cc2)C1 |
| InChI | InChI=1S/C26H25N5O5S/c1-2-20(32)30-11-3-4-15(12-30)28-24(33)23-22-21-19(9-10-27-25(21)37-23)31(26(34)29-22)16-5-7-17(8-6-16)36-18-13-35-14-18/h2,5-10,15,18H,1,3-4,11-14H2,(H,28,33)(H,29,34) |
| InChIKey | DSEVQLOLIQOLJM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|