C27H29N5O5S2 — CID 130474814
7-(4-tert-butylsulfonylphenyl)-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 130474814) has the molecular formula C27H29N5O5S2 and a molecular weight of 567.69 g/mol. Its IUPAC name is 7-(4-tert-butylsulfonylphenyl)-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(4-tert-butylsulfonylphenyl)-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 130474814 |
| Molecular Formula | C27H29N5O5S2 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 7-(4-tert-butylsulfonylphenyl)-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(S(=O)(=O)C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C27H29N5O5S2/c1-5-20(33)31-14-6-7-16(15-31)29-24(34)23-22-21-19(12-13-28-25(21)38-23)32(26(35)30-22)17-8-10-18(11-9-17)39(36,37)27(2,3)4/h5,8-13,16H,1,6-7,14-15H2,2-4H3,(H,29,34)(H,30,35)/t16-/m1/s1 |
| InChIKey | IKGHCQZCWPZGKN-MRXNPFEDSA-N |
| XLogP | 4.46 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|