C25H27N5O4S — CID 161160691
methoxymethane;6-oxo-7-phenyl-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 161160691) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is methoxymethane;6-oxo-7-phenyl-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | methoxymethane;6-oxo-7-phenyl-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 161160691 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | methoxymethane;6-oxo-7-phenyl-N-(1-prop-2-enoylpiperidin-3-yl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCCC(NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccccc2)C1.COC |
| InChI | InChI=1S/C23H21N5O3S.C2H6O/c1-2-17(29)27-12-6-7-14(13-27)25-21(30)20-19-18-16(10-11-24-22(18)32-20)28(23(31)26-19)15-8-4-3-5-9-15;1-3-2/h2-5,8-11,14H,1,6-7,12-13H2,(H,25,30)(H,26,31);1-2H3 |
| InChIKey | UPWMKGUWJWBWFN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|