C24H19ClF3N5O3S — CID 129222925
7-[4-chloro-3-(trifluoromethyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129222925) has the molecular formula C24H19ClF3N5O3S and a molecular weight of 549.96 g/mol. Its IUPAC name is 7-[4-chloro-3-(trifluoromethyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[4-chloro-3-(trifluoromethyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129222925 |
| Molecular Formula | C24H19ClF3N5O3S |
| Molecular Weight | 549.96 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | 7-[4-chloro-3-(trifluoromethyl)phenyl]-6-oxo-N-[(3R)-1-prop-2-enoylpiperidin-3-yl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H19ClF3N5O3S/c1-2-17(34)32-9-3-4-12(11-32)30-21(35)20-19-18-16(7-8-29-22(18)37-20)33(23(36)31-19)13-5-6-15(25)14(10-13)24(26,27)28/h2,5-8,10,12H,1,3-4,9,11H2,(H,30,35)(H,31,36)/t12-/m1/s1 |
| InChIKey | HAMXYTHZWVFEOY-GFCCVEGCSA-N |
| XLogP | 5.56 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.96 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|