C31H31N5O4S — CID 130475392
tert-butyl (3R)-3-[[6-oxo-7-(4-phenylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 130475392) has the molecular formula C31H31N5O4S and a molecular weight of 569.69 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[6-oxo-7-(4-phenylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[6-oxo-7-(4-phenylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130475392 |
| Molecular Formula | C31H31N5O4S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | tert-butyl (3R)-3-[[6-oxo-7-(4-phenylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C31H31N5O4S/c1-31(2,3)40-30(39)35-17-7-10-21(18-35)33-27(37)26-25-24-23(15-16-32-28(24)41-26)36(29(38)34-25)22-13-11-20(12-14-22)19-8-5-4-6-9-19/h4-6,8-9,11-16,21H,7,10,17-18H2,1-3H3,(H,33,37)(H,34,38)/t21-/m1/s1 |
| InChIKey | HHHUCBODTRSYFM-OAQYLSRUSA-N |
| XLogP | 6.78 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |