C28H25N5O4S — CID 129220548
3-[[7-(3-benzylphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylic acid (PubChem CID 129220548) has the molecular formula C28H25N5O4S and a molecular weight of 527.61 g/mol. Its IUPAC name is 3-[[7-(3-benzylphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[7-(3-benzylphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 129220548 |
| Molecular Formula | C28H25N5O4S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 3-[[7-(3-benzylphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]piperidine-1-carboxylic acid |
| SMILES | O=C(NC1CCCN(C(=O)O)C1)c1sc2nccc3c2c1NC(=O)N3c1cccc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C28H25N5O4S/c34-25(30-19-9-5-13-32(16-19)28(36)37)24-23-22-21(11-12-29-26(22)38-24)33(27(35)31-23)20-10-4-8-18(15-20)14-17-6-2-1-3-7-17/h1-4,6-8,10-12,15,19H,5,9,13-14,16H2,(H,30,34)(H,31,35)(H,36,37) |
| InChIKey | JTWJJGIMZKNDIH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |