C30H28FN5O5S2 — CID 142369201
tert-butyl (3R,4S)-3-fluoro-4-[[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]-3-sulfanylpyrrolidine-1-carboxylate (PubChem CID 142369201) has the molecular formula C30H28FN5O5S2 and a molecular weight of 621.72 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-fluoro-4-[[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]-3-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-fluoro-4-[[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]-3-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142369201 |
| Molecular Formula | C30H28FN5O5S2 |
| Molecular Weight | 621.72 g/mol |
| Exact Mass | 621.15 |
| IUPAC Name | tert-butyl (3R,4S)-3-fluoro-4-[[6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carbonyl]amino]-3-sulfanylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)cc2)[C@](F)(S)C1 |
| InChI | InChI=1S/C30H28FN5O5S2/c1-29(2,3)41-28(39)35-15-21(30(31,42)16-35)33-25(37)24-23-22-20(13-14-32-26(22)43-24)36(27(38)34-23)17-9-11-19(12-10-17)40-18-7-5-4-6-8-18/h4-14,21,42H,15-16H2,1-3H3,(H,33,37)(H,34,38)/t21-,30+/m0/s1 |
| InChIKey | DYAURPYETXUPJX-URAOTHONSA-N |
| XLogP | 6.72 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|