C26H23N5O4S — CID 129223011
N-[(4S)-4-methoxypyrrolidin-3-yl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129223011) has the molecular formula C26H23N5O4S and a molecular weight of 501.57 g/mol. Its IUPAC name is N-[(4S)-4-methoxypyrrolidin-3-yl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(4S)-4-methoxypyrrolidin-3-yl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129223011 |
| Molecular Formula | C26H23N5O4S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-[(4S)-4-methoxypyrrolidin-3-yl]-6-oxo-7-(4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CO[C@H]1CNCC1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5O4S/c1-34-20-14-27-13-18(20)29-24(32)23-22-21-19(11-12-28-25(21)36-23)31(26(33)30-22)15-7-9-17(10-8-15)35-16-5-3-2-4-6-16/h2-12,18,20,27H,13-14H2,1H3,(H,29,32)(H,30,33)/t18?,20-/m0/s1 |
| InChIKey | VSBSSULLWVCLFP-IJHRGXPZSA-N |
| XLogP | 4.49 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |