C29H27N5O4S — CID 142369276
6-oxo-7-(4-phenoxyphenyl)-N-[(1R,2R)-2-(propanoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 142369276) has the molecular formula C29H27N5O4S and a molecular weight of 541.63 g/mol. Its IUPAC name is 6-oxo-7-(4-phenoxyphenyl)-N-[(1R,2R)-2-(propanoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-7-(4-phenoxyphenyl)-N-[(1R,2R)-2-(propanoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 142369276 |
| Molecular Formula | C29H27N5O4S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 6-oxo-7-(4-phenoxyphenyl)-N-[(1R,2R)-2-(propanoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CCC(=O)N[C@@H]1CCC[C@H]1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27N5O4S/c1-2-23(35)31-20-9-6-10-21(20)32-27(36)26-25-24-22(15-16-30-28(24)39-26)34(29(37)33-25)17-11-13-19(14-12-17)38-18-7-4-3-5-8-18/h3-5,7-8,11-16,20-21H,2,6,9-10H2,1H3,(H,31,35)(H,32,36)(H,33,37)/t20-,21-/m1/s1 |
| InChIKey | VITPEFAXJDNIFP-NHCUHLMSSA-N |
| XLogP | 5.95 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |