C28H26N6O4S — CID 155174209
N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 155174209) has the molecular formula C28H26N6O4S and a molecular weight of 542.62 g/mol. Its IUPAC name is N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 155174209 |
| Molecular Formula | C28H26N6O4S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-6-oxo-7-(4-pyridin-3-yloxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(O)N[C@H]1CCC[C@H]1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1ccc(Oc2cccnc2)cc1 |
| InChI | InChI=1S/C28H26N6O4S/c1-2-22(35)31-19-6-3-7-20(19)32-26(36)25-24-23-21(12-14-30-27(23)39-25)34(28(37)33-24)16-8-10-17(11-9-16)38-18-5-4-13-29-15-18/h2,4-5,8-15,19-20,22,31,35H,1,3,6-7H2,(H,32,36)(H,33,37)/t19-,20+,22?/m0/s1 |
| InChIKey | GBXAZCLWNUAQTN-RJKSWSIASA-N |
| XLogP | 4.91 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|