C22H20N6O3S — CID 129234092
6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129234092) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129234092 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)NC1CCCC1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1cccnc1 |
| InChI | InChI=1S/C22H20N6O3S/c1-2-16(29)25-13-6-3-7-14(13)26-20(30)19-18-17-15(8-10-24-21(17)32-19)28(22(31)27-18)12-5-4-9-23-11-12/h2,4-5,8-11,13-14H,1,3,6-7H2,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | AMKOMDRNDUXHIC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|