C25H28N6O3S — CID 157099542
6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-2-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;propane (PubChem CID 157099542) has the molecular formula C25H28N6O3S and a molecular weight of 492.61 g/mol. Its IUPAC name is 6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-2-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;propane.
| Compound Name | 6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-2-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;propane |
|---|---|
| PubChem CID | 157099542 |
| Molecular Formula | C25H28N6O3S |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 6-oxo-N-[2-(prop-2-enoylamino)cyclopentyl]-7-pyridin-2-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide;propane |
| SMILES | C=CC(=O)NC1CCCC1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1ccccn1.CCC |
| InChI | InChI=1S/C22H20N6O3S.C3H8/c1-2-16(29)25-12-6-5-7-13(12)26-20(30)19-18-17-14(9-11-24-21(17)32-19)28(22(31)27-18)15-8-3-4-10-23-15;1-3-2/h2-4,8-13H,1,5-7H2,(H,25,29)(H,26,30)(H,27,31);3H2,1-2H3 |
| InChIKey | AFPJQQOPOKIKAF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|