C28H24N6O3S — CID 129233691
6-oxo-N-[(1R)-2-(prop-2-enoylamino)cyclopentyl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129233691) has the molecular formula C28H24N6O3S and a molecular weight of 524.61 g/mol. Its IUPAC name is 6-oxo-N-[(1R)-2-(prop-2-enoylamino)cyclopentyl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-N-[(1R)-2-(prop-2-enoylamino)cyclopentyl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129233691 |
| Molecular Formula | C28H24N6O3S |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 6-oxo-N-[(1R)-2-(prop-2-enoylamino)cyclopentyl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)NC1CCC[C@H]1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C28H24N6O3S/c1-2-22(35)31-19-9-4-10-20(19)32-26(36)25-24-23-21(11-13-30-27(23)38-25)34(28(37)33-24)18-8-3-6-16(14-18)17-7-5-12-29-15-17/h2-3,5-8,11-15,19-20H,1,4,9-10H2,(H,31,35)(H,32,36)(H,33,37)/t19?,20-/m1/s1 |
| InChIKey | RPXVMSVDVAEYDF-GFOWMXPYSA-N |
| XLogP | 4.99 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|