C25H22N6O2S — CID 129220346
6-oxo-N-[(3R)-piperidin-3-yl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129220346) has the molecular formula C25H22N6O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is 6-oxo-N-[(3R)-piperidin-3-yl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 6-oxo-N-[(3R)-piperidin-3-yl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129220346 |
| Molecular Formula | C25H22N6O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 6-oxo-N-[(3R)-piperidin-3-yl]-7-(3-pyridin-3-ylphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCNC1)c1sc2nccc3c2c1NC(=O)N3c1cccc(-c2cccnc2)c1 |
| InChI | InChI=1S/C25H22N6O2S/c32-23(29-17-6-3-10-27-14-17)22-21-20-19(8-11-28-24(20)34-22)31(25(33)30-21)18-7-1-4-15(12-18)16-5-2-9-26-13-16/h1-2,4-5,7-9,11-13,17,27H,3,6,10,14H2,(H,29,32)(H,30,33)/t17-/m1/s1 |
| InChIKey | YQIMIWPHGZDIMV-QGZVFWFLSA-N |
| XLogP | 4.52 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |